C19H18F5N3O4S — CID 177305849
2-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 177305849) has the molecular formula C19H18F5N3O4S and a molecular weight of 479.43 g/mol. Its IUPAC name is 2-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 177305849 |
| Molecular Formula | C19H18F5N3O4S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 2-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3nc(C(N)=O)cs3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C19H18F5N3O4S/c1-7-11(8-4-5-9(20)12(21)13(8)30-3)14(31-18(7,2)19(22,23)24)16(29)27-17-26-10(6-32-17)15(25)28/h4-7,11,14H,1-3H3,(H2,25,28)(H,26,27,29)/t7-,11-,14+,18+/m0/s1 |
| InChIKey | AYKOGBJXVWZYJT-SKUQUJRJSA-N |
| XLogP | 3.61 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |