C23H21F5N4O4 — CID 166160569
6-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 166160569) has the molecular formula C23H21F5N4O4 and a molecular weight of 512.44 g/mol. Its IUPAC name is 6-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166160569 |
| Molecular Formula | C23H21F5N4O4 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 6-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc4nc(C(N)=O)cn4c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H21F5N4O4/c1-10-16(12-5-6-13(24)17(25)18(12)35-3)19(36-22(10,2)23(26,27)28)21(34)30-11-4-7-15-31-14(20(29)33)9-32(15)8-11/h4-10,16,19H,1-3H3,(H2,29,33)(H,30,34)/t10-,16-,19+,22+/m0/s1 |
| InChIKey | RJMFVCOGMLOURN-LWDWCFRYSA-N |
| XLogP | 3.80 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |