C21H19BrF5N3O4 — CID 176860480
6-bromo-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 176860480) has the molecular formula C21H19BrF5N3O4 and a molecular weight of 552.29 g/mol. Its IUPAC name is 6-bromo-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-bromo-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176860480 |
| Molecular Formula | C21H19BrF5N3O4 |
| Molecular Weight | 552.29 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 6-bromo-4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc(Br)nc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H19BrF5N3O4/c1-8-14(10-4-5-11(23)15(24)16(10)33-3)17(34-20(8,2)21(25,26)27)19(32)29-9-6-12(18(28)31)30-13(22)7-9/h4-8,14,17H,1-3H3,(H2,28,31)(H,29,30,32)/t8-,14-,17+,20+/m0/s1 |
| InChIKey | OESWEWQUFUWHNS-TXMJIMEESA-N |
| XLogP | 4.31 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|