C21H20F5N3O4 — CID 169047170
6-[[(2S,3S,4R,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 169047170) has the molecular formula C21H20F5N3O4 and a molecular weight of 473.40 g/mol. Its IUPAC name is 6-[[(2S,3S,4R,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 6-[[(2S,3S,4R,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169047170 |
| Molecular Formula | C21H20F5N3O4 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 6-[[(2S,3S,4R,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@@H](C(=O)Nc3cccc(C(N)=O)n3)O[C@@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H20F5N3O4/c1-9-14(10-7-8-11(22)15(23)16(10)32-3)17(33-20(9,2)21(24,25)26)19(31)29-13-6-4-5-12(28-13)18(27)30/h4-9,14,17H,1-3H3,(H2,27,30)(H,28,29,31)/t9-,14+,17+,20-/m1/s1 |
| InChIKey | QPURUMKJNZYDSU-MKRNUISJSA-N |
| XLogP | 3.55 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |