C25H27F5N4O4 — CID 167221529
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(piperazine-1-carbonyl)-2-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167221529) has the molecular formula C25H27F5N4O4 and a molecular weight of 542.51 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(piperazine-1-carbonyl)-2-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(piperazine-1-carbonyl)-2-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167221529 |
| Molecular Formula | C25H27F5N4O4 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(piperazine-1-carbonyl)-2-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cccc(C(=O)N4CCNCC4)n3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H27F5N4O4/c1-13-18(14-7-8-15(26)19(27)20(14)37-3)21(38-24(13,2)25(28,29)30)22(35)33-17-6-4-5-16(32-17)23(36)34-11-9-31-10-12-34/h4-8,13,18,21,31H,9-12H2,1-3H3,(H,32,33,35)/t13-,18-,21+,24+/m0/s1 |
| InChIKey | ZFYNCBHLGLJSAI-HTKNNQJKSA-N |
| XLogP | 3.49 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |