C22H24F5N3O3 — CID 166160235
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160235) has the molecular formula C22H24F5N3O3 and a molecular weight of 473.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160235 |
| Molecular Formula | C22H24F5N3O3 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cnc4n3CCCC4)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H24F5N3O3/c1-11-16(12-7-8-13(23)17(24)18(12)32-3)19(33-21(11,2)22(25,26)27)20(31)29-15-10-28-14-6-4-5-9-30(14)15/h7-8,10-11,16,19H,4-6,9H2,1-3H3,(H,29,31)/t11-,16-,19+,21+/m0/s1 |
| InChIKey | DIECXZCMGCAAQN-YFVHLLGCSA-N |
| XLogP | 4.58 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |