C20H18BrF5N2O3 — CID 167211949
(2R,3S,4S,5R)-N-(6-bromo-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167211949) has the molecular formula C20H18BrF5N2O3 and a molecular weight of 509.27 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-(6-bromo-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-(6-bromo-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167211949 |
| Molecular Formula | C20H18BrF5N2O3 |
| Molecular Weight | 509.27 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | (2R,3S,4S,5R)-N-(6-bromo-3-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc(Br)nc3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H18BrF5N2O3/c1-9-14(11-5-6-12(22)15(23)16(11)30-3)17(31-19(9,2)20(24,25)26)18(29)28-10-4-7-13(21)27-8-10/h4-9,14,17H,1-3H3,(H,28,29)/t9-,14-,17+,19+/m0/s1 |
| InChIKey | SHSTYEWFOQZMNW-IUWPEGGASA-N |
| XLogP | 5.21 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|