C23H25F5N2O5 — CID 167299107
(3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1-hydroxy-2-methoxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167299107) has the molecular formula C23H25F5N2O5 and a molecular weight of 504.45 g/mol. Its IUPAC name is (3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1-hydroxy-2-methoxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1-hydroxy-2-methoxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167299107 |
| Molecular Formula | C23H25F5N2O5 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1-hydroxy-2-methoxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COC[C@H](O)c1ccc(NC(=O)C2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)cn1 |
| InChI | InChI=1S/C23H25F5N2O5/c1-11-17(13-6-7-14(24)18(25)19(13)34-4)20(35-22(11,2)23(26,27)28)21(32)30-12-5-8-15(29-9-12)16(31)10-33-3/h5-9,11,16-17,20,31H,10H2,1-4H3,(H,30,32)/t11-,16-,17-,20?,22+/m0/s1 |
| InChIKey | UBPPPRKBGDVNIU-NGLVXCIASA-N |
| XLogP | 4.13 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |