C27H32F5N3O6 — CID 166160022
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-morpholin-4-ylethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160022) has the molecular formula C27H32F5N3O6 and a molecular weight of 589.56 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-morpholin-4-ylethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-morpholin-4-ylethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160022 |
| Molecular Formula | C27H32F5N3O6 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-morpholin-4-ylethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCCN2CCOCC2)[C@H](C(=O)Nc2ccc([C@@H](O)CO)nc2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C27H32F5N3O6/c1-15-21(17-4-5-18(28)22(29)23(17)40-12-9-35-7-10-39-11-8-35)24(41-26(15,2)27(30,31)32)25(38)34-16-3-6-19(33-13-16)20(37)14-36/h3-6,13,15,20-21,24,36-37H,7-12,14H2,1-2H3,(H,34,38)/t15-,20-,21-,24+,26+/m0/s1 |
| InChIKey | SNFORKYGVYXWLN-HEVKCGKTSA-N |
| XLogP | 3.17 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |