C26H29F6N3O5 — CID 166160956
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-[(1R)-1-hydroxy-2-morpholin-4-ylethyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160956) has the molecular formula C26H29F6N3O5 and a molecular weight of 577.52 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-[(1R)-1-hydroxy-2-morpholin-4-ylethyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-[(1R)-1-hydroxy-2-morpholin-4-ylethyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160956 |
| Molecular Formula | C26H29F6N3O5 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[5-fluoro-2-[(1R)-1-hydroxy-2-morpholin-4-ylethyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc([C@H](O)CN4CCOCC4)ncc3F)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C26H29F6N3O5/c1-13-20(14-4-5-15(27)21(29)22(14)38-3)23(40-25(13,2)26(30,31)32)24(37)34-17-10-18(33-11-16(17)28)19(36)12-35-6-8-39-9-7-35/h4-5,10-11,13,19-20,23,36H,6-9,12H2,1-3H3,(H,33,34,37)/t13-,19+,20-,23+,25+/m0/s1 |
| InChIKey | ZYENYUCMQLVFTB-UJRQLYEQSA-N |
| XLogP | 3.95 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |