C25H28F5N3O4 — CID 167211854
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(3R)-4-methylmorpholin-3-yl]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167211854) has the molecular formula C25H28F5N3O4 and a molecular weight of 529.51 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(3R)-4-methylmorpholin-3-yl]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(3R)-4-methylmorpholin-3-yl]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167211854 |
| Molecular Formula | C25H28F5N3O4 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(3R)-4-methylmorpholin-3-yl]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc([C@@H]4COCCN4C)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H28F5N3O4/c1-13-19(15-5-6-16(26)20(27)21(15)35-4)22(37-24(13,2)25(28,29)30)23(34)32-14-7-8-31-17(11-14)18-12-36-10-9-33(18)3/h5-8,11,13,18-19,22H,9-10,12H2,1-4H3,(H,31,32,34)/t13-,18-,19-,22+,24+/m0/s1 |
| InChIKey | CKYQKALODJFJEH-MNLNTQONSA-N |
| XLogP | 4.45 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |