C23H24F5N3O5 — CID 167221197
4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-(2-hydroxyethyl)pyridine-2-carboxamide (PubChem CID 167221197) has the molecular formula C23H24F5N3O5 and a molecular weight of 517.45 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-(2-hydroxyethyl)pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-(2-hydroxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167221197 |
| Molecular Formula | C23H24F5N3O5 |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-(2-hydroxyethyl)pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(=O)NCCO)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H24F5N3O5/c1-11-16(13-4-5-14(24)17(25)18(13)35-3)19(36-22(11,2)23(26,27)28)21(34)31-12-6-7-29-15(10-12)20(33)30-8-9-32/h4-7,10-11,16,19,32H,8-9H2,1-3H3,(H,30,33)(H,29,31,34)/t11-,16-,19+,22+/m0/s1 |
| InChIKey | FEDVBCSONBPJRK-GHXGHCGASA-N |
| XLogP | 3.17 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |