C24H25F5N2O6 — CID 166159512
methyl 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-methoxyethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate (PubChem CID 166159512) has the molecular formula C24H25F5N2O6 and a molecular weight of 532.46 g/mol. Its IUPAC name is methyl 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-methoxyethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-methoxyethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166159512 |
| Molecular Formula | C24H25F5N2O6 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | methyl 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-methoxyethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate |
| SMILES | COCCOc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(=O)OC)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C24H25F5N2O6/c1-12-17(14-5-6-15(25)18(26)19(14)36-10-9-34-3)20(37-23(12,2)24(27,28)29)21(32)31-13-7-8-30-16(11-13)22(33)35-4/h5-8,11-12,17,20H,9-10H2,1-4H3,(H,30,31,32)/t12-,17-,20+,23+/m0/s1 |
| InChIKey | TUDARUIKWDWFSQ-ZWQRXXSJSA-N |
| XLogP | 4.25 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|