C25H28F5N3O6 — CID 166159464
4-[[(2R,3S,4S,5R)-3-[2-(2,3-dimethoxypropoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166159464) has the molecular formula C25H28F5N3O6 and a molecular weight of 561.50 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[2-(2,3-dimethoxypropoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[2-(2,3-dimethoxypropoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159464 |
| Molecular Formula | C25H28F5N3O6 |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[2-(2,3-dimethoxypropoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COCC(COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F)OC |
| InChI | InChI=1S/C25H28F5N3O6/c1-12-18(15-5-6-16(26)19(27)20(15)38-11-14(37-4)10-36-3)21(39-24(12,2)25(28,29)30)23(35)33-13-7-8-32-17(9-13)22(31)34/h5-9,12,14,18,21H,10-11H2,1-4H3,(H2,31,34)(H,32,33,35)/t12-,14?,18-,21+,24+/m0/s1 |
| InChIKey | JHBCGLDRYIAFAH-MOIZFPEPSA-N |
| XLogP | 3.58 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |