C22H21F6N3O4 — CID 156535697
4-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 156535697) has the molecular formula C22H21F6N3O4 and a molecular weight of 505.42 g/mol. Its IUPAC name is 4-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156535697 |
| Molecular Formula | C22H21F6N3O4 |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 4-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | Cc1c(F)ccc([C@@H]2[C@@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)c1OC(F)F |
| InChI | InChI=1S/C22H21F6N3O4/c1-9-13(23)5-4-12(16(9)34-20(24)25)15-10(2)21(3,22(26,27)28)35-17(15)19(33)31-11-6-7-30-14(8-11)18(29)32/h4-8,10,15,17,20H,1-3H3,(H2,29,32)(H,30,31,33)/t10-,15-,17+,21+/m1/s1 |
| InChIKey | BCMPVFJLPUNIGA-XVLJMXMMSA-N |
| XLogP | 4.31 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |