C22H20F7N3O4 — CID 169047081
4-[[(2R,3R,4R,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-5-methylpyridine-2-carboxamide (PubChem CID 169047081) has the molecular formula C22H20F7N3O4 and a molecular weight of 523.41 g/mol. Its IUPAC name is 4-[[(2R,3R,4R,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-5-methylpyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3R,4R,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-5-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169047081 |
| Molecular Formula | C22H20F7N3O4 |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 4-[[(2R,3R,4R,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-5-methylpyridine-2-carboxamide |
| SMILES | Cc1cnc(C(N)=O)cc1NC(=O)[C@@H]1O[C@@](C)(C(F)(F)F)[C@H](C)[C@@H]1c1ccc(F)c(F)c1OC(F)F |
| InChI | InChI=1S/C22H20F7N3O4/c1-8-7-31-13(18(30)33)6-12(8)32-19(34)17-14(9(2)21(3,36-17)22(27,28)29)10-4-5-11(23)15(24)16(10)35-20(25)26/h4-7,9,14,17,20H,1-3H3,(H2,30,33)(H,31,32,34)/t9-,14-,17-,21-/m1/s1 |
| InChIKey | QGKJGASJJMWMRV-SAHPVPRJSA-N |
| XLogP | 4.45 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |