C22H19F7N2O4 — CID 156535680
(2R,3R,4S,5S)-N-(3-carbamoylphenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 156535680) has the molecular formula C22H19F7N2O4 and a molecular weight of 508.39 g/mol. Its IUPAC name is (2R,3R,4S,5S)-N-(3-carbamoylphenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3R,4S,5S)-N-(3-carbamoylphenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 156535680 |
| Molecular Formula | C22H19F7N2O4 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (2R,3R,4S,5S)-N-(3-carbamoylphenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@H](c2ccc(F)c(F)c2OC(F)F)[C@H](C(=O)Nc2cccc(C(N)=O)c2)O[C@]1(C)C(F)(F)F |
| InChI | InChI=1S/C22H19F7N2O4/c1-9-14(12-6-7-13(23)15(24)16(12)34-20(25)26)17(35-21(9,2)22(27,28)29)19(33)31-11-5-3-4-10(8-11)18(30)32/h3-9,14,17,20H,1-2H3,(H2,30,32)(H,31,33)/t9-,14+,17+,21-/m0/s1 |
| InChIKey | CUCKWBCZSYAYTR-DYJPNZKISA-N |
| XLogP | 4.74 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |