C22H21F5N2O4 — CID 159071067
(2R,3S,4R)-N-(3-carbamoyl-4-fluorophenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 159071067) has the molecular formula C22H21F5N2O4 and a molecular weight of 472.41 g/mol. Its IUPAC name is (2R,3S,4R)-N-(3-carbamoyl-4-fluorophenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4R)-N-(3-carbamoyl-4-fluorophenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 159071067 |
| Molecular Formula | C22H21F5N2O4 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (2R,3S,4R)-N-(3-carbamoyl-4-fluorophenyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | C[C@@H]1[C@@H](c2ccc(F)c(F)c2OC(F)F)[C@H](C(=O)Nc2ccc(F)c(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C22H21F5N2O4/c1-9-15(11-5-7-14(24)16(25)17(11)32-21(26)27)18(33-22(9,2)3)20(31)29-10-4-6-13(23)12(8-10)19(28)30/h4-9,15,18,21H,1-3H3,(H2,28,30)(H,29,31)/t9-,15+,18-/m1/s1 |
| InChIKey | JZQRDDWMMUFEOJ-AHRODOEDSA-N |
| XLogP | 4.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |