C22H22F4N2O4 — CID 170407719
(2R,3S,4R)-N-(2-acetyl-4-pyridinyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170407719) has the molecular formula C22H22F4N2O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is (2R,3S,4R)-N-(2-acetyl-4-pyridinyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4R)-N-(2-acetyl-4-pyridinyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170407719 |
| Molecular Formula | C22H22F4N2O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (2R,3S,4R)-N-(2-acetyl-4-pyridinyl)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | CC(=O)c1cc(NC(=O)[C@@H]2OC(C)(C)[C@H](C)[C@H]2c2ccc(F)c(F)c2OC(F)F)ccn1 |
| InChI | InChI=1S/C22H22F4N2O4/c1-10-16(13-5-6-14(23)17(24)18(13)31-21(25)26)19(32-22(10,3)4)20(30)28-12-7-8-27-15(9-12)11(2)29/h5-10,16,19,21H,1-4H3,(H,27,28,30)/t10-,16+,19-/m1/s1 |
| InChIKey | SURNXFPDNUWASS-ULMSCDGUSA-N |
| XLogP | 4.70 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |