C21H23F2N3O4 — CID 158193084
3-deuterio-4-[[(2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 158193084) has the molecular formula C21H23F2N3O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-deuterio-4-[[(2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 3-deuterio-4-[[(2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 158193084 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-deuterio-4-[[(2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | [2H]c1c(NC(=O)[C@@H]2OC(C)(C)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)ccnc1C(N)=O |
| InChI | InChI=1S/C21H23F2N3O4/c1-10-15(12-5-6-13(22)16(23)17(12)29-4)18(30-21(10,2)3)20(28)26-11-7-8-25-14(9-11)19(24)27/h5-10,15,18H,1-4H3,(H2,24,27)(H,25,26,28)/t10-,15-,18+/m0/s1/i9D |
| InChIKey | FZZUFCCASGNUBQ-UDTXIXTGSA-N |
| XLogP | 3.00 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |