C22H26F2N2O5 — CID 166160259
(2S,3R,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 166160259) has the molecular formula C22H26F2N2O5 and a molecular weight of 436.46 g/mol. Its IUPAC name is (2S,3R,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2S,3R,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160259 |
| Molecular Formula | C22H26F2N2O5 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (2S,3R,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc([C@H](O)CO)c3)OC(C)(C)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H26F2N2O5/c1-11-17(13-5-6-14(23)18(24)19(13)30-4)20(31-22(11,2)3)21(29)26-12-7-8-25-15(9-12)16(28)10-27/h5-9,11,16-17,20,27-28H,10H2,1-4H3,(H,25,26,29)/t11-,16-,17-,20+/m1/s1 |
| InChIKey | XLPQFLPXKSYFOV-ZMTUXBBYSA-N |
| XLogP | 2.93 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |