C22H26F2N2O6 — CID 167206116
(2S,3S,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4-methoxy-5,5-dimethyloxolane-2-carboxamide (PubChem CID 167206116) has the molecular formula C22H26F2N2O6 and a molecular weight of 452.45 g/mol. Its IUPAC name is (2S,3S,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4-methoxy-5,5-dimethyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4-methoxy-5,5-dimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 167206116 |
| Molecular Formula | C22H26F2N2O6 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2S,3S,4R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-4-pyridinyl]-4-methoxy-5,5-dimethyloxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc([C@H](O)CO)c3)OC(C)(C)[C@@H]2OC)ccc(F)c1F |
| InChI | InChI=1S/C22H26F2N2O6/c1-22(2)20(31-4)16(12-5-6-13(23)17(24)18(12)30-3)19(32-22)21(29)26-11-7-8-25-14(9-11)15(28)10-27/h5-9,15-16,19-20,27-28H,10H2,1-4H3,(H,25,26,29)/t15-,16-,19+,20-/m1/s1 |
| InChIKey | HXULLUUSBGESPF-YAJHFMINSA-N |
| XLogP | 2.31 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |