C23H24F5N3O4 — CID 156545968
(2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-4-cyclopropyl-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 156545968) has the molecular formula C23H24F5N3O4 and a molecular weight of 501.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-4-cyclopropyl-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-4-cyclopropyl-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 156545968 |
| Molecular Formula | C23H24F5N3O4 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (2R,3S,4S,5R)-N-[2-[amino(hydroxy)methyl]-4-pyridinyl]-4-cyclopropyl-3-(3,4-difluoro-2-methoxyphenyl)-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(N)O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C2CC2)ccc(F)c1F |
| InChI | InChI=1S/C23H24F5N3O4/c1-22(23(26,27)28)16(10-3-4-10)15(12-5-6-13(24)17(25)18(12)34-2)19(35-22)21(33)31-11-7-8-30-14(9-11)20(29)32/h5-10,15-16,19-20,32H,3-4,29H2,1-2H3,(H,30,31,33)/t15-,16+,19-,20?,22-/m1/s1 |
| InChIKey | GSLZXHXRQUHKGP-CUUBYDIBSA-N |
| XLogP | 3.79 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|