C21H21F5N2O5S — CID 166160828
(2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160828) has the molecular formula C21H21F5N2O5S and a molecular weight of 508.47 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160828 |
| Molecular Formula | C21H21F5N2O5S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | (2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc(S(C)(=O)=O)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H21F5N2O5S/c1-10-15(12-5-6-13(22)16(23)17(12)32-3)18(33-20(10,2)21(24,25)26)19(29)28-11-7-8-27-14(9-11)34(4,30)31/h5-10,15,18H,1-4H3,(H,27,28,29)/t10-,15-,18+,20+/m1/s1 |
| InChIKey | BBCXDIWNUGFACI-XUBQHOJVSA-N |
| XLogP | 3.85 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |