C22H23F5N2O6S — CID 171478533
[4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]methyl methanesulfonate (PubChem CID 171478533) has the molecular formula C22H23F5N2O6S and a molecular weight of 538.49 g/mol. Its IUPAC name is [4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]methyl methanesulfonate.
| Compound Name | [4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 171478533 |
| Molecular Formula | C22H23F5N2O6S |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | [4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]methyl methanesulfonate |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(COS(C)(=O)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H23F5N2O6S/c1-11-16(14-5-6-15(23)17(24)18(14)33-3)19(35-21(11,2)22(25,26)27)20(30)29-12-7-8-28-13(9-12)10-34-36(4,31)32/h5-9,11,16,19H,10H2,1-4H3,(H,28,29,30)/t11-,16-,19+,21+/m0/s1 |
| InChIKey | XOHVYVJYGVPHKJ-YFVHLLGCSA-N |
| XLogP | 3.92 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|