C24H25F5N2O5 — CID 175806247
[(1R)-1-[4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]ethyl] acetate (PubChem CID 175806247) has the molecular formula C24H25F5N2O5 and a molecular weight of 516.46 g/mol. Its IUPAC name is [(1R)-1-[4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]ethyl] acetate.
| Compound Name | [(1R)-1-[4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]ethyl] acetate |
|---|---|
| PubChem CID | 175806247 |
| Molecular Formula | C24H25F5N2O5 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [(1R)-1-[4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-2-pyridinyl]ethyl] acetate |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc([C@@H](C)OC(C)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C24H25F5N2O5/c1-11-18(15-6-7-16(25)19(26)20(15)34-5)21(36-23(11,4)24(27,28)29)22(33)31-14-8-9-30-17(10-14)12(2)35-13(3)32/h6-12,18,21H,1-5H3,(H,30,31,33)/t11-,12+,18-,21+,23+/m0/s1 |
| InChIKey | FPOVIIJQEPDQRH-GSHGHHNHSA-N |
| XLogP | 5.07 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |