C20H20F5N3O3 — CID 176882162
(2S,3R,4R,5S)-N-(2-amino-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 176882162) has the molecular formula C20H20F5N3O3 and a molecular weight of 445.39 g/mol. Its IUPAC name is (2S,3R,4R,5S)-N-(2-amino-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-N-(2-amino-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 176882162 |
| Molecular Formula | C20H20F5N3O3 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (2S,3R,4R,5S)-N-(2-amino-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc(N)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H20F5N3O3/c1-9-14(11-4-5-12(21)15(22)16(11)30-3)17(31-19(9,2)20(23,24)25)18(29)28-10-6-7-27-13(26)8-10/h4-9,14,17H,1-3H3,(H3,26,27,28,29)/t9-,14-,17+,19+/m1/s1 |
| InChIKey | HNCYSKCZYRVAQG-DIBVBMKDSA-N |
| XLogP | 4.03 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |