C24H25F5N4O4 — CID 176860319
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(2-hydroxy-3-methyl-2H-imidazol-1-yl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 176860319) has the molecular formula C24H25F5N4O4 and a molecular weight of 528.48 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(2-hydroxy-3-methyl-2H-imidazol-1-yl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(2-hydroxy-3-methyl-2H-imidazol-1-yl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 176860319 |
| Molecular Formula | C24H25F5N4O4 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-(2-hydroxy-3-methyl-2H-imidazol-1-yl)-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(N4C=CN(C)C4O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C24H25F5N4O4/c1-12-17(14-5-6-15(25)18(26)19(14)36-4)20(37-23(12,2)24(27,28)29)21(34)31-13-7-8-30-16(11-13)33-10-9-32(3)22(33)35/h5-12,17,20,22,35H,1-4H3,(H,30,31,34)/t12-,17-,20+,22?,23+/m0/s1 |
| InChIKey | UPKXQCCYQJIKPG-KJBDYPJDSA-N |
| XLogP | 3.95 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |