C25H27F5N4O3 — CID 167212299
(2R,3S,4S,5R)-N-[2-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167212299) has the molecular formula C25H27F5N4O3 and a molecular weight of 526.51 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[2-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[2-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167212299 |
| Molecular Formula | C25H27F5N4O3 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | (2R,3S,4S,5R)-N-[2-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-pyridinyl]-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(N4C[C@H]5C[C@@H]4CN5)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H27F5N4O3/c1-12-19(16-4-5-17(26)20(27)21(16)36-3)22(37-24(12,2)25(28,29)30)23(35)33-13-6-7-31-18(9-13)34-11-14-8-15(34)10-32-14/h4-7,9,12,14-15,19,22,32H,8,10-11H2,1-3H3,(H,31,33,35)/t12-,14+,15+,19-,22+,24+/m0/s1 |
| InChIKey | HEEFKLUINHVCGB-UPUNJCAISA-N |
| XLogP | 4.00 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |