C22H21F5N6O3 — CID 170959218
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(2-methyltetrazol-5-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 170959218) has the molecular formula C22H21F5N6O3 and a molecular weight of 512.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(2-methyltetrazol-5-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(2-methyltetrazol-5-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 170959218 |
| Molecular Formula | C22H21F5N6O3 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(2-methyltetrazol-5-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(-c4nnn(C)n4)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H21F5N6O3/c1-10-15(12-5-6-13(23)16(24)17(12)35-4)18(36-21(10,2)22(25,26)27)20(34)29-11-7-8-28-14(9-11)19-30-32-33(3)31-19/h5-10,15,18H,1-4H3,(H,28,29,34)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | DGIVZNUMBATBHG-TZDAZOALSA-N |
| XLogP | 3.64 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |