C27H31F5N4O4 — CID 166159873
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(3R)-3,4-dimethylpiperazine-1-carbonyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166159873) has the molecular formula C27H31F5N4O4 and a molecular weight of 570.56 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(3R)-3,4-dimethylpiperazine-1-carbonyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(3R)-3,4-dimethylpiperazine-1-carbonyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166159873 |
| Molecular Formula | C27H31F5N4O4 |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(3R)-3,4-dimethylpiperazine-1-carbonyl]-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(=O)N4CCN(C)[C@H](C)C4)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C27H31F5N4O4/c1-14-13-36(11-10-35(14)4)25(38)19-12-16(8-9-33-19)34-24(37)23-20(15(2)26(3,40-23)27(30,31)32)17-6-7-18(28)21(29)22(17)39-5/h6-9,12,14-15,20,23H,10-11,13H2,1-5H3,(H,33,34,37)/t14-,15+,20+,23-,26-/m1/s1 |
| InChIKey | ULIFZNCVOHGCDH-BCNYLCRCSA-N |
| XLogP | 4.22 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |