C24H23F5N2O5 — CID 177357772
4-[[(2R,3S,4S,5R)-3-(2-cyclobutyloxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylic acid (PubChem CID 177357772) has the molecular formula C24H23F5N2O5 and a molecular weight of 514.45 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-(2-cyclobutyloxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-(2-cyclobutyloxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 177357772 |
| Molecular Formula | C24H23F5N2O5 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-(2-cyclobutyloxy-3,4-difluorophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylic acid |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OC2CCC2)[C@H](C(=O)Nc2ccnc(C(=O)O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C24H23F5N2O5/c1-11-17(14-6-7-15(25)18(26)19(14)35-13-4-3-5-13)20(36-23(11,2)24(27,28)29)21(32)31-12-8-9-30-16(10-12)22(33)34/h6-11,13,17,20H,3-5H2,1-2H3,(H,33,34)(H,30,31,32)/t11-,17-,20+,23+/m0/s1 |
| InChIKey | ACYGDARGNRYTNN-LBOCZGAHSA-N |
| XLogP | 5.07 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |