C25H26F6N4O4 — CID 167221260
4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[(3-fluoro-1-methylazetidin-3-yl)methoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 167221260) has the molecular formula C25H26F6N4O4 and a molecular weight of 560.50 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[(3-fluoro-1-methylazetidin-3-yl)methoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[(3-fluoro-1-methylazetidin-3-yl)methoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167221260 |
| Molecular Formula | C25H26F6N4O4 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[(3-fluoro-1-methylazetidin-3-yl)methoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCC2(F)CN(C)C2)[C@H](C(=O)Nc2ccnc(C(N)=O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C25H26F6N4O4/c1-12-17(14-4-5-15(26)18(27)19(14)38-11-24(28)9-35(3)10-24)20(39-23(12,2)25(29,30)31)22(37)34-13-6-7-33-16(8-13)21(32)36/h4-8,12,17,20H,9-11H2,1-3H3,(H2,32,36)(H,33,34,37)/t12-,17-,20+,23+/m0/s1 |
| InChIKey | RPHASMYBNFMYSU-ZWQRXXSJSA-N |
| XLogP | 3.57 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |