C25H28F5N3O6 — CID 166159521
4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(hydroxymethyl)-3-methoxypropoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166159521) has the molecular formula C25H28F5N3O6 and a molecular weight of 561.50 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(hydroxymethyl)-3-methoxypropoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(hydroxymethyl)-3-methoxypropoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159521 |
| Molecular Formula | C25H28F5N3O6 |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(hydroxymethyl)-3-methoxypropoxy]phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | COCC(CO)COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(N)=O)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C25H28F5N3O6/c1-12-18(15-4-5-16(26)19(27)20(15)38-11-13(9-34)10-37-3)21(39-24(12,2)25(28,29)30)23(36)33-14-6-7-32-17(8-14)22(31)35/h4-8,12-13,18,21,34H,9-11H2,1-3H3,(H2,31,35)(H,32,33,36)/t12-,13?,18-,21+,24+/m0/s1 |
| InChIKey | IEROIFGYHDMICJ-QMBQBVCXSA-N |
| XLogP | 3.17 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |