C25H23F5N4O4 — CID 167221137
4-[[(2R,3S,4S,5R)-3-[2-(3-cyanocyclobutyl)oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 167221137) has the molecular formula C25H23F5N4O4 and a molecular weight of 538.47 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[2-(3-cyanocyclobutyl)oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[2-(3-cyanocyclobutyl)oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167221137 |
| Molecular Formula | C25H23F5N4O4 |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[2-(3-cyanocyclobutyl)oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OC2CC(C#N)C2)[C@H](C(=O)Nc2ccnc(C(N)=O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C25H23F5N4O4/c1-11-18(15-3-4-16(26)19(27)20(15)37-14-7-12(8-14)10-31)21(38-24(11,2)25(28,29)30)23(36)34-13-5-6-33-17(9-13)22(32)35/h3-6,9,11-12,14,18,21H,7-8H2,1-2H3,(H2,32,35)(H,33,34,36)/t11-,12?,14?,18-,21+,24+/m0/s1 |
| InChIKey | WNSSJHFQPCRJQT-IQJAAMLWSA-N |
| XLogP | 4.22 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |