C22H22F5N3O4 — CID 169046975
4-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 169046975) has the molecular formula C22H22F5N3O4 and a molecular weight of 487.40 g/mol. Its IUPAC name is 4-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169046975 |
| Molecular Formula | C22H22F5N3O4 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-[[(2S,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4-ethyl-5-methyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | CC[C@H]1[C@H]([C@H](O[C@@]1(C)C(F)(F)F)C(=O)NC2=CC(=NC=C2)C(=O)N)C3=C(C(=C(C=C3)F)F)OC |
| InChI | InChI=1S/C22H22F5N3O4/c1-4-12-15(11-5-6-13(23)16(24)17(11)33-3)18(34-21(12,2)22(25,26)27)20(32)30-10-7-8-29-14(9-10)19(28)31/h5-9,12,15,18H,4H2,1-3H3,(H2,28,31)(H,29,30,32)/t12-,15+,18-,21+/m0/s1 |
| InChIKey | HAJIQSQNYDCASS-BGJSMJEVSA-N |
| XLogP | 3.40 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | 757 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |