C21H22F5N3O4S — CID 166160764
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylsulfonimidoyl)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160764) has the molecular formula C21H22F5N3O4S and a molecular weight of 507.48 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylsulfonimidoyl)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylsulfonimidoyl)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160764 |
| Molecular Formula | C21H22F5N3O4S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[6-(methylsulfonimidoyl)-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | [H]N=[S@](C)(=O)c1ccc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)cn1 |
| InChI | InChI=1S/C21H22F5N3O4S/c1-10-15(12-6-7-13(22)16(23)17(12)32-3)18(33-20(10,2)21(24,25)26)19(30)29-11-5-8-14(28-9-11)34(4,27)31/h5-10,15,18,27H,1-4H3,(H,29,30)/t10-,15-,18+,20+,34+/m0/s1 |
| InChIKey | HWDDIRBFKLZWJN-KCYLAVGISA-N |
| XLogP | 4.48 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |