C22H22F6N2O5S — CID 167211540
(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167211540) has the molecular formula C22H22F6N2O5S and a molecular weight of 540.48 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167211540 |
| Molecular Formula | C22H22F6N2O5S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (2S,3R,4R,5S)-3-[2-(difluoromethoxy)-4-fluoro-3-methylphenyl]-4,5-dimethyl-N-(2-methylsulfonyl-4-pyridinyl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | Cc1c(F)ccc([C@@H]2[C@@H](C(=O)Nc3ccnc(S(C)(=O)=O)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)c1OC(F)F |
| InChI | InChI=1S/C22H22F6N2O5S/c1-10-14(23)6-5-13(17(10)34-20(24)25)16-11(2)21(3,22(26,27)28)35-18(16)19(31)30-12-7-8-29-15(9-12)36(4,32)33/h5-9,11,16,18,20H,1-4H3,(H,29,30,31)/t11-,16-,18+,21+/m1/s1 |
| InChIKey | DGQJJQWAILTOKW-YFFFRIPXSA-N |
| XLogP | 4.61 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |