C24H23F7N4O4 — CID 167211561
(2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-[2-(2-oxopiperazin-1-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167211561) has the molecular formula C24H23F7N4O4 and a molecular weight of 564.46 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-[2-(2-oxopiperazin-1-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-[2-(2-oxopiperazin-1-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167211561 |
| Molecular Formula | C24H23F7N4O4 |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-[2-(2-oxopiperazin-1-yl)-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OC(F)F)[C@H](C(=O)Nc2ccnc(N3CCNCC3=O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C24H23F7N4O4/c1-11-17(13-3-4-14(25)18(26)19(13)38-22(27)28)20(39-23(11,2)24(29,30)31)21(37)34-12-5-6-33-15(9-12)35-8-7-32-10-16(35)36/h3-6,9,11,17,20,22,32H,7-8,10H2,1-2H3,(H,33,34,37)/t11-,17-,20+,23+/m0/s1 |
| InChIKey | XDCVAHZXTJJKSH-LBOCZGAHSA-N |
| XLogP | 3.98 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |