C21H18F7N3O4 — CID 166161174
5-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166161174) has the molecular formula C21H18F7N3O4 and a molecular weight of 509.38 g/mol. Its IUPAC name is 5-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 5-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166161174 |
| Molecular Formula | C21H18F7N3O4 |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 5-[[(2S,3R,4R,5S)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@H](c2ccc(F)c(F)c2OC(F)F)[C@@H](C(=O)Nc2ccc(C(N)=O)nc2)O[C@]1(C)C(F)(F)F |
| InChI | InChI=1S/C21H18F7N3O4/c1-8-13(10-4-5-11(22)14(23)15(10)34-19(24)25)16(35-20(8,2)21(26,27)28)18(33)31-9-3-6-12(17(29)32)30-7-9/h3-8,13,16,19H,1-2H3,(H2,29,32)(H,31,33)/t8-,13-,16+,20+/m1/s1 |
| InChIKey | DIMQUXCHTNTDLU-VMCJJVEWSA-N |
| XLogP | 4.14 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |