C21H21F4N3O4 — CID 157449935
4-[[(2S,3S,4R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 157449935) has the molecular formula C21H21F4N3O4 and a molecular weight of 455.41 g/mol. Its IUPAC name is 4-[[(2S,3S,4R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2S,3S,4R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 157449935 |
| Molecular Formula | C21H21F4N3O4 |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 4-[[(2S,3S,4R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5,5-trimethyloxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H](c2ccc(F)c(F)c2OC(F)F)[C@@H](C(=O)Nc2ccnc(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C21H21F4N3O4/c1-9-14(11-4-5-12(22)15(23)16(11)31-20(24)25)17(32-21(9,2)3)19(30)28-10-6-7-27-13(8-10)18(26)29/h4-9,14,17,20H,1-3H3,(H2,26,29)(H,27,28,30)/t9-,14+,17+/m1/s1 |
| InChIKey | BSRIESNFEZKFLX-ZVTRXGDXSA-N |
| XLogP | 3.60 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |