C22H24F2N2O3 — CID 170407919
(2R,3S,4S)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170407919) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is (2R,3S,4S)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4S)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170407919 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2R,3S,4S)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | CC(=O)c1cc(NC(=O)[C@@H]2OC(C)(C)[C@@H](C)[C@H]2c2ccc(F)c(F)c2C)ccn1 |
| InChI | InChI=1S/C22H24F2N2O3/c1-11-15(6-7-16(23)19(11)24)18-12(2)22(4,5)29-20(18)21(28)26-14-8-9-25-17(10-14)13(3)27/h6-10,12,18,20H,1-5H3,(H,25,26,28)/t12-,18-,20+/m0/s1 |
| InChIKey | UEMDIIDHKUORLE-FOPRYUNUSA-N |
| XLogP | 4.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |