C21H22F2N2O4 — CID 170407805
(2R,3R,4R,5R)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carboxamide (PubChem CID 170407805) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is (2R,3R,4R,5R)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carboxamide.
| Compound Name | (2R,3R,4R,5R)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170407805 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2R,3R,4R,5R)-N-(2-acetyl-4-pyridinyl)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@@H](C)[C@@H](C)O[C@H]2C(=O)Nc2ccnc(C(C)=O)c2)ccc(F)c1F |
| InChI | InChI=1S/C21H22F2N2O4/c1-10-12(3)29-20(17(10)14-5-6-15(22)18(23)19(14)28-4)21(27)25-13-7-8-24-16(9-13)11(2)26/h5-10,12,17,20H,1-4H3,(H,24,25,27)/t10-,12+,17+,20+/m0/s1 |
| InChIKey | GDBUNNXFBSXMSE-ZBOSTYNHSA-N |
| XLogP | 3.72 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |