C22H26F2N2O6 — CID 166161634
(2R,3R,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(2R)-1,2-dihydroxypropan-2-yl]-4-pyridinyl]-4-methoxy-5-methyloxolane-2-carboxamide (PubChem CID 166161634) has the molecular formula C22H26F2N2O6 and a molecular weight of 452.45 g/mol. Its IUPAC name is (2R,3R,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(2R)-1,2-dihydroxypropan-2-yl]-4-pyridinyl]-4-methoxy-5-methyloxolane-2-carboxamide.
| Compound Name | (2R,3R,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(2R)-1,2-dihydroxypropan-2-yl]-4-pyridinyl]-4-methoxy-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 166161634 |
| Molecular Formula | C22H26F2N2O6 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2R,3R,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(2R)-1,2-dihydroxypropan-2-yl]-4-pyridinyl]-4-methoxy-5-methyloxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@H](OC)[C@H](C)O[C@H]2C(=O)Nc2ccnc([C@@](C)(O)CO)c2)ccc(F)c1F |
| InChI | InChI=1S/C22H26F2N2O6/c1-11-18(30-3)16(13-5-6-14(23)17(24)19(13)31-4)20(32-11)21(28)26-12-7-8-25-15(9-12)22(2,29)10-27/h5-9,11,16,18,20,27,29H,10H2,1-4H3,(H,25,26,28)/t11-,16+,18+,20+,22-/m0/s1 |
| InChIKey | XQYPHXYIHRLMKB-NHZGYTNRSA-N |
| XLogP | 2.09 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |