C21H22F2N2O5 — CID 165176326
methyl 4-[[(2R,3S,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carbonyl]amino]pyridine-2-carboxylate (PubChem CID 165176326) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is methyl 4-[[(2R,3S,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carbonyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[[(2R,3S,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carbonyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 165176326 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 4-[[(2R,3S,4S,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyloxolane-2-carbonyl]amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)[C@@H]2O[C@@H](C)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)ccn1 |
| InChI | InChI=1S/C21H22F2N2O5/c1-10-11(2)30-19(16(10)13-5-6-14(22)17(23)18(13)28-3)20(26)25-12-7-8-24-15(9-12)21(27)29-4/h5-11,16,19H,1-4H3,(H,24,25,26)/t10-,11+,16+,19-/m1/s1 |
| InChIKey | FEMYGOZEMGJIFI-XLYNDAROSA-N |
| XLogP | 3.30 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |