C26H33FN2O4 — CID 170395856
(2R,3S,4S)-N-[6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-pyridinyl]-3-(4-fluoro-2,3-dimethylphenyl)-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170395856) has the molecular formula C26H33FN2O4 and a molecular weight of 456.56 g/mol. Its IUPAC name is (2R,3S,4S)-N-[6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-pyridinyl]-3-(4-fluoro-2,3-dimethylphenyl)-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4S)-N-[6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-pyridinyl]-3-(4-fluoro-2,3-dimethylphenyl)-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170395856 |
| Molecular Formula | C26H33FN2O4 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2R,3S,4S)-N-[6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-pyridinyl]-3-(4-fluoro-2,3-dimethylphenyl)-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | Cc1c(F)ccc([C@H]2[C@H](C(=O)Nc3ccc([C@H]4COC(C)(C)O4)nc3)OC(C)(C)[C@H]2C)c1C |
| InChI | InChI=1S/C26H33FN2O4/c1-14-15(2)19(27)10-9-18(14)22-16(3)25(4,5)33-23(22)24(30)29-17-8-11-20(28-12-17)21-13-31-26(6,7)32-21/h8-12,16,21-23H,13H2,1-7H3,(H,29,30)/t16-,21+,22-,23+/m0/s1 |
| InChIKey | MONHXZWEURNOQJ-AZIXLERZSA-N |
| XLogP | 5.20 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |