C22H25F3N2O4 — CID 170395744
(2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-2-fluoro-1-hydroxyethyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170395744) has the molecular formula C22H25F3N2O4 and a molecular weight of 438.45 g/mol. Its IUPAC name is (2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-2-fluoro-1-hydroxyethyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-2-fluoro-1-hydroxyethyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170395744 |
| Molecular Formula | C22H25F3N2O4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-2-fluoro-1-hydroxyethyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc([C@H](O)CF)nc3)OC(C)(C)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H25F3N2O4/c1-11-17(13-6-7-14(24)18(25)19(13)30-4)20(31-22(11,2)3)21(29)27-12-5-8-15(26-10-12)16(28)9-23/h5-8,10-11,16-17,20,28H,9H2,1-4H3,(H,27,29)/t11-,16+,17-,20+/m0/s1 |
| InChIKey | BRXQQGWIHATXLY-PFKHYPITSA-N |
| XLogP | 3.91 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |