C23H28F2N2O5 — CID 170395646
(2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170395646) has the molecular formula C23H28F2N2O5 and a molecular weight of 450.48 g/mol. Its IUPAC name is (2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170395646 |
| Molecular Formula | C23H28F2N2O5 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (2R,3S,4S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc([C@@H](O)[C@@H](C)O)nc3)OC(C)(C)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H28F2N2O5/c1-11-17(14-7-8-15(24)18(25)20(14)31-5)21(32-23(11,3)4)22(30)27-13-6-9-16(26-10-13)19(29)12(2)28/h6-12,17,19,21,28-29H,1-5H3,(H,27,30)/t11-,12+,17-,19-,21+/m0/s1 |
| InChIKey | KRFXKPVDAAFBJQ-ZRYNGJMTSA-N |
| XLogP | 3.32 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |