C23H29FN2O5 — CID 170395688
(2R,3S,4S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170395688) has the molecular formula C23H29FN2O5 and a molecular weight of 432.49 g/mol. Its IUPAC name is (2R,3S,4S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170395688 |
| Molecular Formula | C23H29FN2O5 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (2R,3S,4S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc([C@H](O)CO)nc3)OC(C)(C)[C@H]2C)ccc(F)c1C |
| InChI | InChI=1S/C23H29FN2O5/c1-12-16(24)8-7-15(20(12)30-5)19-13(2)23(3,4)31-21(19)22(29)26-14-6-9-17(25-10-14)18(28)11-27/h6-10,13,18-19,21,27-28H,11H2,1-5H3,(H,26,29)/t13-,18+,19-,21+/m0/s1 |
| InChIKey | AYKJNOAUMHEUAK-DXRQPORESA-N |
| XLogP | 3.10 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |