C22H22F6N2O5 — CID 166160181
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-5-fluoro-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160181) has the molecular formula C22H22F6N2O5 and a molecular weight of 508.42 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-5-fluoro-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-5-fluoro-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160181 |
| Molecular Formula | C22H22F6N2O5 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[2-[(1S)-1,2-dihydroxyethyl]-5-fluoro-4-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cc([C@H](O)CO)ncc3F)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H22F6N2O5/c1-9-16(10-4-5-11(23)17(25)18(10)34-3)19(35-21(9,2)22(26,27)28)20(33)30-13-6-14(15(32)8-31)29-7-12(13)24/h4-7,9,15-16,19,31-32H,8H2,1-3H3,(H,29,30,33)/t9-,15+,16-,19+,21+/m0/s1 |
| InChIKey | FBVPTRKBUJYQFP-QPNUWENNSA-N |
| XLogP | 3.61 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |